C7H13NO2S — CID 10997560
3-(1-hydroxybutan-2-yl)-1,3-thiazolidin-4-one (PubChem CID 10997560) has the molecular formula C7H13NO2S and a molecular weight of 175.25 g/mol. Its IUPAC name is 3-(1-hydroxybutan-2-yl)-1,3-thiazolidin-4-one.
| Compound Name | 3-(1-hydroxybutan-2-yl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 10997560 |
| Molecular Formula | C7H13NO2S |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 3-(1-hydroxybutan-2-yl)-1,3-thiazolidin-4-one |
| SMILES | CCC(CO)N1CSCC1=O |
| InChI | InChI=1S/C7H13NO2S/c1-2-6(3-9)8-5-11-4-7(8)10/h6,9H,2-5H2,1H3 |
| InChIKey | OMZAIHNWFBVYTA-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |