C6H11NO2S — CID 11955010
3-(3-hydroxypropyl)-1,3-thiazolidin-4-one (PubChem CID 11955010) has the molecular formula C6H11NO2S and a molecular weight of 161.23 g/mol. Its IUPAC name is 3-(3-hydroxypropyl)-1,3-thiazolidin-4-one.
| Compound Name | 3-(3-hydroxypropyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 11955010 |
| Molecular Formula | C6H11NO2S |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 3-(3-hydroxypropyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CSCN1CCCO |
| InChI | InChI=1S/C6H11NO2S/c8-3-1-2-7-5-10-4-6(7)9/h8H,1-5H2 |
| InChIKey | CKWMKVZLSYDNKE-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |