C9H16N2O2S — CID 20648669
2,2-dimethyl-3-[2-(methylamino)acetyl]-1,3-thiazolidine-4-carbaldehyde (PubChem CID 20648669) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is 2,2-dimethyl-3-[2-(methylamino)acetyl]-1,3-thiazolidine-4-carbaldehyde.
| Compound Name | 2,2-dimethyl-3-[2-(methylamino)acetyl]-1,3-thiazolidine-4-carbaldehyde |
|---|---|
| PubChem CID | 20648669 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 2,2-dimethyl-3-[2-(methylamino)acetyl]-1,3-thiazolidine-4-carbaldehyde |
| SMILES | CNCC(=O)N1C(C=O)CSC1(C)C |
| InChI | InChI=1S/C9H16N2O2S/c1-9(2)11(8(13)4-10-3)7(5-12)6-14-9/h5,7,10H,4,6H2,1-3H3 |
| InChIKey | LLRRLJGUEWZMBD-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|