C7H12N2O2S — CID 20648853
3-[2-(methylamino)acetyl]-1,3-thiazolidine-4-carbaldehyde (PubChem CID 20648853) has the molecular formula C7H12N2O2S and a molecular weight of 188.25 g/mol. Its IUPAC name is 3-[2-(methylamino)acetyl]-1,3-thiazolidine-4-carbaldehyde.
| Compound Name | 3-[2-(methylamino)acetyl]-1,3-thiazolidine-4-carbaldehyde |
|---|---|
| PubChem CID | 20648853 |
| Molecular Formula | C7H12N2O2S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 3-[2-(methylamino)acetyl]-1,3-thiazolidine-4-carbaldehyde |
| SMILES | CNCC(=O)N1CSCC1C=O |
| InChI | InChI=1S/C7H12N2O2S/c1-8-2-7(11)9-5-12-4-6(9)3-10/h3,6,8H,2,4-5H2,1H3 |
| InChIKey | JZNRZYSETWWZJR-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|