C7H14N2OS — CID 43263478
N-ethyl-N-methyl-1,3-thiazolidine-4-carboxamide (PubChem CID 43263478) has the molecular formula C7H14N2OS and a molecular weight of 174.27 g/mol. Its IUPAC name is N-ethyl-N-methyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-ethyl-N-methyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 43263478 |
| Molecular Formula | C7H14N2OS |
| Molecular Weight | 174.27 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | N-ethyl-N-methyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CCN(C)C(=O)C1CSCN1 |
| InChI | InChI=1S/C7H14N2OS/c1-3-9(2)7(10)6-4-11-5-8-6/h6,8H,3-5H2,1-2H3 |
| InChIKey | NYTWLGQVUGEBIU-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.27 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |