C5H10N2OS — CID 518692
2-methyl-1,3-thiazolidine-2-carboxamide (PubChem CID 518692) has the molecular formula C5H10N2OS and a molecular weight of 146.22 g/mol. Its IUPAC name is 2-methyl-1,3-thiazolidine-2-carboxamide.
| Compound Name | 2-methyl-1,3-thiazolidine-2-carboxamide |
|---|---|
| PubChem CID | 518692 |
| Molecular Formula | C5H10N2OS |
| Molecular Weight | 146.22 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | 2-methyl-1,3-thiazolidine-2-carboxamide |
| SMILES | CC1(C(N)=O)NCCS1 |
| InChI | InChI=1S/C5H10N2OS/c1-5(4(6)8)7-2-3-9-5/h7H,2-3H2,1H3,(H2,6,8) |
| InChIKey | JMAFWCZDYHKNPQ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.22 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |