C7H13N3O — CID 123441292
3,8-diazabicyclo[4.2.0]octane-1-carboxamide (PubChem CID 123441292) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is 3,8-diazabicyclo[4.2.0]octane-1-carboxamide.
| Compound Name | 3,8-diazabicyclo[4.2.0]octane-1-carboxamide |
|---|---|
| PubChem CID | 123441292 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 3,8-diazabicyclo[4.2.0]octane-1-carboxamide |
| SMILES | NC(=O)C12CNCCC1CN2 |
| InChI | InChI=1S/C7H13N3O/c8-6(11)7-4-9-2-1-5(7)3-10-7/h5,9-10H,1-4H2,(H2,8,11) |
| InChIKey | DMFZCRCWBKPCKL-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |