C7H12N2O3S — CID 178190689
(3aS,6aS)-2,2-dioxo-1,3,4,5,6,6a-hexahydrothieno[3,4-c]pyrrole-3a-carboxamide (PubChem CID 178190689) has the molecular formula C7H12N2O3S and a molecular weight of 204.25 g/mol. Its IUPAC name is (3aS,6aS)-2,2-dioxo-1,3,4,5,6,6a-hexahydrothieno[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | (3aS,6aS)-2,2-dioxo-1,3,4,5,6,6a-hexahydrothieno[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 178190689 |
| Molecular Formula | C7H12N2O3S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | (3aS,6aS)-2,2-dioxo-1,3,4,5,6,6a-hexahydrothieno[3,4-c]pyrrole-3a-carboxamide |
| SMILES | NC(=O)[C@@]12CNC[C@H]1CS(=O)(=O)C2 |
| InChI | InChI=1S/C7H12N2O3S/c8-6(10)7-3-9-1-5(7)2-13(11,12)4-7/h5,9H,1-4H2,(H2,8,10)/t5-,7+/m0/s1 |
| InChIKey | KKCVDRKIPQOCCT-CAHLUQPWSA-N |
| XLogP | -1.89 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |