C7H10O5S — CID 125449000
(3aR,6aS)-5,5-dioxo-3,4,6,6a-tetrahydro-1H-thieno[3,4-c]furan-3a-carboxylic acid (PubChem CID 125449000) has the molecular formula C7H10O5S and a molecular weight of 206.22 g/mol. Its IUPAC name is (3aR,6aS)-5,5-dioxo-3,4,6,6a-tetrahydro-1H-thieno[3,4-c]furan-3a-carboxylic acid.
| Compound Name | (3aR,6aS)-5,5-dioxo-3,4,6,6a-tetrahydro-1H-thieno[3,4-c]furan-3a-carboxylic acid |
|---|---|
| PubChem CID | 125449000 |
| Molecular Formula | C7H10O5S |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | (3aR,6aS)-5,5-dioxo-3,4,6,6a-tetrahydro-1H-thieno[3,4-c]furan-3a-carboxylic acid |
| SMILES | O=C(O)[C@]12COC[C@H]1CS(=O)(=O)C2 |
| InChI | InChI=1S/C7H10O5S/c8-6(9)7-3-12-1-5(7)2-13(10,11)4-7/h5H,1-4H2,(H,8,9)/t5-,7-/m0/s1 |
| InChIKey | QTGHJXSTSWTWFG-FSPLSTOPSA-N |
| XLogP | -0.87 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |