C9H15N — CID 143400629
1-[(E)-but-2-en-2-yl]-3-azabicyclo[3.1.0]hexane (PubChem CID 143400629) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 1-[(E)-but-2-en-2-yl]-3-azabicyclo[3.1.0]hexane.
| Compound Name | 1-[(E)-but-2-en-2-yl]-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 143400629 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 1-[(E)-but-2-en-2-yl]-3-azabicyclo[3.1.0]hexane |
| SMILES | C/C=C(\C)C12CNCC1C2 |
| InChI | InChI=1S/C9H15N/c1-3-7(2)9-4-8(9)5-10-6-9/h3,8,10H,4-6H2,1-2H3/b7-3+ |
| InChIKey | WSUOKIRVXGFSLQ-XVNBXDOJSA-N |
| XLogP | 1.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|