C6H13NS — CID 129361769
(2R)-2-ethyl-2-methyl-1,3-thiazolidine (PubChem CID 129361769) has the molecular formula C6H13NS and a molecular weight of 131.24 g/mol. Its IUPAC name is (2R)-2-ethyl-2-methyl-1,3-thiazolidine.
| Compound Name | (2R)-2-ethyl-2-methyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 129361769 |
| Molecular Formula | C6H13NS |
| Molecular Weight | 131.24 g/mol |
| Exact Mass | 131.08 |
| IUPAC Name | (2R)-2-ethyl-2-methyl-1,3-thiazolidine |
| SMILES | CC[C@]1(C)NCCS1 |
| InChI | InChI=1S/C6H13NS/c1-3-6(2)7-4-5-8-6/h7H,3-5H2,1-2H3/t6-/m1/s1 |
| InChIKey | AGSHBVNPPGEAMB-ZCFIWIBFSA-N |
| XLogP | 1.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |