About ethane;2-ethyl-2-methyl-1,3-dithiolane;methane
ethane;2-ethyl-2-methyl-1,3-dithiolane;methane (PubChem CID 159433157) has the molecular formula C10H26S2
and a molecular weight of 210.45 g/mol. Its IUPAC name is ethane;2-ethyl-2-methyl-1,3-dithiolane;methane.
Molecular Properties
| Compound Name | ethane;2-ethyl-2-methyl-1,3-dithiolane;methane |
| PubChem CID | 159433157 |
| Molecular Formula | C10H26S2 |
| Molecular Weight | 210.45 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | ethane;2-ethyl-2-methyl-1,3-dithiolane;methane |
| SMILES | C.C.CC.CCC1(C)SCCS1 |
| InChI | InChI=1S/C6H12S2.C2H6.2CH4/c1-3-6(2)7-4-5-8-6;1-2;;/h3-5H2,1-2H3;1-2H3;2*1H4 |
| InChIKey | LRFWEVSNAKCRLT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-ethyl-2-methyl-1,3-dithiolane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethyl-2-methyl-1,3-dithiolane;methane?
The IUPAC name of ethane;2-ethyl-2-methyl-1,3-dithiolane;methane (CID 159433157) is ethane;2-ethyl-2-methyl-1,3-dithiolane;methane.
What is the SMILES notation for ethane;2-ethyl-2-methyl-1,3-dithiolane;methane?
The canonical SMILES for ethane;2-ethyl-2-methyl-1,3-dithiolane;methane is C.C.CC.CCC1(C)SCCS1.
What is the InChIKey of ethane;2-ethyl-2-methyl-1,3-dithiolane;methane?
The InChIKey is LRFWEVSNAKCRLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12S2.C2H6.2CH4/c1-3-6(2)7-4-5-8-6;1-2;;/h3-5H2,1-2H3;1-2H3;2*1H4.
What are the key properties of ethane;2-ethyl-2-methyl-1,3-dithiolane;methane?
ethane;2-ethyl-2-methyl-1,3-dithiolane;methane has a molecular weight of 210.45 g/mol, XLogP of 4.89, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethyl-2-methyl-1,3-dithiolane;methane is sourced from PubChem (CID 159433157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).