C8H16S3 — CID 529049
3,5-di(propan-2-yl)-1,2,4-trithiolane (PubChem CID 529049) has the molecular formula C8H16S3 and a molecular weight of 208.42 g/mol. Its IUPAC name is 3,5-di(propan-2-yl)-1,2,4-trithiolane.
| Compound Name | 3,5-di(propan-2-yl)-1,2,4-trithiolane |
|---|---|
| PubChem CID | 529049 |
| Molecular Formula | C8H16S3 |
| Molecular Weight | 208.42 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 3,5-di(propan-2-yl)-1,2,4-trithiolane |
| SMILES | CC(C)C1SSC(C(C)C)S1 |
| InChI | InChI=1S/C8H16S3/c1-5(2)7-9-8(6(3)4)11-10-7/h5-8H,1-4H3 |
| InChIKey | QCTAPVCDZUSECS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|