C6H13NO3S — CID 67913382
carbonic acid;2,2-dimethyl-1,3-thiazolidine (PubChem CID 67913382) has the molecular formula C6H13NO3S and a molecular weight of 179.24 g/mol. Its IUPAC name is carbonic acid;2,2-dimethyl-1,3-thiazolidine.
| Compound Name | carbonic acid;2,2-dimethyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 67913382 |
| Molecular Formula | C6H13NO3S |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | carbonic acid;2,2-dimethyl-1,3-thiazolidine |
| SMILES | CC1(C)NCCS1.O=C(O)O |
| InChI | InChI=1S/C5H11NS.CH2O3/c1-5(2)6-3-4-7-5;2-1(3)4/h6H,3-4H2,1-2H3;(H2,2,3,4) |
| InChIKey | MRVWFPJVDYDLAW-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |