3-propanoyl-1,3-thiazolidine-2-carboxylic acid

C7H11NO3S — CID 20648923

IUPAC3-propanoyl-1,3-thiazolidine-2-carboxylic acid
SMILESCCC(=O)N1CCSC1C(=O)O
InChIInChI=1S/C7H11NO3S/c1-2-5(9)8-3-4-12-6(8)7(10)11/h6H,2-4H2,1H3,(H,10,11)
InChIKeyRITRDEOWSGDSNO-UHFFFAOYSA-N
MW189.24 g/mol
LogP0.38
Rot. Bonds2

About 3-propanoyl-1,3-thiazolidine-2-carboxylic acid

3-propanoyl-1,3-thiazolidine-2-carboxylic acid (PubChem CID 20648923) has the molecular formula C7H11NO3S and a molecular weight of 189.24 g/mol. Its IUPAC name is 3-propanoyl-1,3-thiazolidine-2-carboxylic acid.

Molecular Properties

Compound Name3-propanoyl-1,3-thiazolidine-2-carboxylic acid
PubChem CID20648923
Molecular FormulaC7H11NO3S
Molecular Weight189.24 g/mol
Exact Mass189.05
IUPAC Name3-propanoyl-1,3-thiazolidine-2-carboxylic acid
SMILESCCC(=O)N1CCSC1C(=O)O
InChIInChI=1S/C7H11NO3S/c1-2-5(9)8-3-4-12-6(8)7(10)11/h6H,2-4H2,1H3,(H,10,11)
InChIKeyRITRDEOWSGDSNO-UHFFFAOYSA-N
XLogP0.38
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.24
LogP ≤ 50.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-propanoyl-1,3-thiazolidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-propanoyl-1,3-thiazolidine-2-carboxylic acid?
The IUPAC name of 3-propanoyl-1,3-thiazolidine-2-carboxylic acid (CID 20648923) is 3-propanoyl-1,3-thiazolidine-2-carboxylic acid.
What is the SMILES notation for 3-propanoyl-1,3-thiazolidine-2-carboxylic acid?
The canonical SMILES for 3-propanoyl-1,3-thiazolidine-2-carboxylic acid is CCC(=O)N1CCSC1C(=O)O.
What is the InChIKey of 3-propanoyl-1,3-thiazolidine-2-carboxylic acid?
The InChIKey is RITRDEOWSGDSNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3S/c1-2-5(9)8-3-4-12-6(8)7(10)11/h6H,2-4H2,1H3,(H,10,11).
What are the key properties of 3-propanoyl-1,3-thiazolidine-2-carboxylic acid?
3-propanoyl-1,3-thiazolidine-2-carboxylic acid has a molecular weight of 189.24 g/mol, XLogP of 0.38, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propanoyl-1,3-thiazolidine-2-carboxylic acid is sourced from PubChem (CID 20648923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).