C23H19F2NO3 — CID 20649181
methyl 4-[[(E)-(3,5-difluorophenyl)methylideneamino]oxymethyl]-2-(2-methylphenyl)benzoate (PubChem CID 20649181) has the molecular formula C23H19F2NO3 and a molecular weight of 395.41 g/mol. Its IUPAC name is methyl 4-[[(E)-(3,5-difluorophenyl)methylideneamino]oxymethyl]-2-(2-methylphenyl)benzoate.
| Compound Name | methyl 4-[[(E)-(3,5-difluorophenyl)methylideneamino]oxymethyl]-2-(2-methylphenyl)benzoate |
|---|---|
| PubChem CID | 20649181 |
| Molecular Formula | C23H19F2NO3 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | methyl 4-[[(E)-(3,5-difluorophenyl)methylideneamino]oxymethyl]-2-(2-methylphenyl)benzoate |
| SMILES | COC(=O)c1ccc(CO/N=C/c2cc(F)cc(F)c2)cc1-c1ccccc1C |
| InChI | InChI=1S/C23H19F2NO3/c1-15-5-3-4-6-20(15)22-11-16(7-8-21(22)23(27)28-2)14-29-26-13-17-9-18(24)12-19(25)10-17/h3-13H,14H2,1-2H3/b26-13+ |
| InChIKey | CKUJRUSLJPNYEU-LGJNPRDNSA-N |
| XLogP | 5.28 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|