C13H23NO2 — CID 20649869
1-(7-oxabicyclo[2.2.1]hept-5-en-2-ylmethylamino)hexan-2-ol (PubChem CID 20649869) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 1-(7-oxabicyclo[2.2.1]hept-5-en-2-ylmethylamino)hexan-2-ol.
| Compound Name | 1-(7-oxabicyclo[2.2.1]hept-5-en-2-ylmethylamino)hexan-2-ol |
|---|---|
| PubChem CID | 20649869 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 1-(7-oxabicyclo[2.2.1]hept-5-en-2-ylmethylamino)hexan-2-ol |
| SMILES | CCCCC(O)CNCC1CC2C=CC1O2 |
| InChI | InChI=1S/C13H23NO2/c1-2-3-4-11(15)9-14-8-10-7-12-5-6-13(10)16-12/h5-6,10-15H,2-4,7-9H2,1H3 |
| InChIKey | FTWLRYIHYLINBA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|