C15H26S — CID 20649978
5-(3-butylsulfanylpropyl)bicyclo[2.2.2]oct-2-ene (PubChem CID 20649978) has the molecular formula C15H26S and a molecular weight of 238.44 g/mol. Its IUPAC name is 5-(3-butylsulfanylpropyl)bicyclo[2.2.2]oct-2-ene.
| Compound Name | 5-(3-butylsulfanylpropyl)bicyclo[2.2.2]oct-2-ene |
|---|---|
| PubChem CID | 20649978 |
| Molecular Formula | C15H26S |
| Molecular Weight | 238.44 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 5-(3-butylsulfanylpropyl)bicyclo[2.2.2]oct-2-ene |
| SMILES | CCCCSCCCC1CC2C=CC1CC2 |
| InChI | InChI=1S/C15H26S/c1-2-3-10-16-11-4-5-15-12-13-6-8-14(15)9-7-13/h6,8,13-15H,2-5,7,9-12H2,1H3 |
| InChIKey | CBLIPKMRYPOOBX-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|