C43H58N5O5S+ — CID 20652862
1-[2-[2-(4-hexoxyphenyl)hydrazinyl]-2-oxoethyl]-N-[2-[2-[[3-(4-hexoxyphenyl)phenyl]methoxyamino]ethylsulfanyl]ethyl]pyridin-1-ium-3-carboxamide (PubChem CID 20652862) has the molecular formula C43H58N5O5S+ and a molecular weight of 757.03 g/mol. Its IUPAC name is 1-[2-[2-(4-hexoxyphenyl)hydrazinyl]-2-oxoethyl]-N-[2-[2-[[3-(4-hexoxyphenyl)phenyl]methoxyamino]ethylsulfanyl]ethyl]pyridin-1-ium-3-carboxamide.
| Compound Name | 1-[2-[2-(4-hexoxyphenyl)hydrazinyl]-2-oxoethyl]-N-[2-[2-[[3-(4-hexoxyphenyl)phenyl]methoxyamino]ethylsulfanyl]ethyl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 20652862 |
| Molecular Formula | C43H58N5O5S+ |
| Molecular Weight | 757.03 g/mol |
| Exact Mass | 756.42 |
| IUPAC Name | 1-[2-[2-(4-hexoxyphenyl)hydrazinyl]-2-oxoethyl]-N-[2-[2-[[3-(4-hexoxyphenyl)phenyl]methoxyamino]ethylsulfanyl]ethyl]pyridin-1-ium-3-carboxamide |
| SMILES | CCCCCCOc1ccc(NNC(=O)C[n+]2cccc(C(=O)NCCSCCNOCc3cccc(-c4ccc(OCCCCCC)cc4)c3)c2)cc1 |
| InChI | InChI=1S/C43H57N5O5S/c1-3-5-7-9-27-51-40-20-16-36(17-21-40)37-14-11-13-35(31-37)34-53-45-25-30-54-29-24-44-43(50)38-15-12-26-48(32-38)33-42(49)47-46-39-18-22-41(23-19-39)52-28-10-8-6-4-2/h11-23,26,31-32,45-46H,3-10,24-25,27-30,33-34H2,1-2H3,(H-,44,47,49,50)/p+1 |
| InChIKey | RCPDOCSHSQSGDL-UHFFFAOYSA-O |
| XLogP | 7.89 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.03 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|