C21H29NO5S — CID 20655017
N-[(2E)-2-(ethoxymethylidene)-1,1,3-trioxo-1-benzothiophen-5-yl]decanamide (PubChem CID 20655017) has the molecular formula C21H29NO5S and a molecular weight of 407.53 g/mol. Its IUPAC name is N-[(2E)-2-(ethoxymethylidene)-1,1,3-trioxo-1-benzothiophen-5-yl]decanamide.
| Compound Name | N-[(2E)-2-(ethoxymethylidene)-1,1,3-trioxo-1-benzothiophen-5-yl]decanamide |
|---|---|
| PubChem CID | 20655017 |
| Molecular Formula | C21H29NO5S |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-[(2E)-2-(ethoxymethylidene)-1,1,3-trioxo-1-benzothiophen-5-yl]decanamide |
| SMILES | CCCCCCCCCC(=O)Nc1ccc2c(c1)C(=O)/C(=C\OCC)S2(=O)=O |
| InChI | InChI=1S/C21H29NO5S/c1-3-5-6-7-8-9-10-11-20(23)22-16-12-13-18-17(14-16)21(24)19(15-27-4-2)28(18,25)26/h12-15H,3-11H2,1-2H3,(H,22,23)/b19-15+ |
| InChIKey | LQQIYFRWMAARGA-XDJHFCHBSA-N |
| XLogP | 4.61 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|