C32H54O2 — CID 20657182
(10,13-dimethyl-17-octan-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) 2-methylbutanoate (PubChem CID 20657182) has the molecular formula C32H54O2 and a molecular weight of 470.78 g/mol. Its IUPAC name is (10,13-dimethyl-17-octan-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) 2-methylbutanoate.
| Compound Name | (10,13-dimethyl-17-octan-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) 2-methylbutanoate |
|---|---|
| PubChem CID | 20657182 |
| Molecular Formula | C32H54O2 |
| Molecular Weight | 470.78 g/mol |
| Exact Mass | 470.41 |
| IUPAC Name | (10,13-dimethyl-17-octan-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) 2-methylbutanoate |
| SMILES | CCCCCCC(C)C1CCC2C3CC=C4CC(OC(=O)C(C)CC)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C32H54O2/c1-7-9-10-11-12-23(4)27-15-16-28-26-14-13-24-21-25(34-30(33)22(3)8-2)17-19-31(24,5)29(26)18-20-32(27,28)6/h13,22-23,25-29H,7-12,14-21H2,1-6H3 |
| InChIKey | YCXUTGLIXOURKU-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.78 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|