C11H25NO — CID 20658869
5,6-dimethyl-3-(methylamino)octan-4-ol (PubChem CID 20658869) has the molecular formula C11H25NO and a molecular weight of 187.33 g/mol. Its IUPAC name is 5,6-dimethyl-3-(methylamino)octan-4-ol.
| Compound Name | 5,6-dimethyl-3-(methylamino)octan-4-ol |
|---|---|
| PubChem CID | 20658869 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | 5,6-dimethyl-3-(methylamino)octan-4-ol |
| SMILES | CCC(C)C(C)C(O)C(CC)NC |
| InChI | InChI=1S/C11H25NO/c1-6-8(3)9(4)11(13)10(7-2)12-5/h8-13H,6-7H2,1-5H3 |
| InChIKey | ARXIGHDCELWGTC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |