C9H19NO — CID 135009947
(3R,4S,5S,6R)-6-ethyl-4,5-dimethylpiperidin-3-ol (PubChem CID 135009947) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is (3R,4S,5S,6R)-6-ethyl-4,5-dimethylpiperidin-3-ol.
| Compound Name | (3R,4S,5S,6R)-6-ethyl-4,5-dimethylpiperidin-3-ol |
|---|---|
| PubChem CID | 135009947 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | (3R,4S,5S,6R)-6-ethyl-4,5-dimethylpiperidin-3-ol |
| SMILES | CC[C@H]1NC[C@H](O)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C9H19NO/c1-4-8-6(2)7(3)9(11)5-10-8/h6-11H,4-5H2,1-3H3/t6-,7-,8+,9-/m0/s1 |
| InChIKey | UFQNMCLYHRODOB-MAUMQABQSA-N |
| XLogP | 1.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |