About (3R,4R)-5-[(1R)-1-fluoropropyl]piperidine-3,4-diol
(3R,4R)-5-[(1R)-1-fluoropropyl]piperidine-3,4-diol (PubChem CID 91824849) has the molecular formula C8H16FNO2
and a molecular weight of 177.22 g/mol. Its IUPAC name is (3R,4R)-5-[(1R)-1-fluoropropyl]piperidine-3,4-diol.
Molecular Properties
| Compound Name | (3R,4R)-5-[(1R)-1-fluoropropyl]piperidine-3,4-diol |
| PubChem CID | 91824849 |
| Molecular Formula | C8H16FNO2 |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (3R,4R)-5-[(1R)-1-fluoropropyl]piperidine-3,4-diol |
| SMILES | CC[C@@H](F)C1CNC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H16FNO2/c1-2-6(9)5-3-10-4-7(11)8(5)12/h5-8,10-12H,2-4H2,1H3/t5?,6-,7-,8-/m1/s1 |
| InChIKey | JJOAXUOFRVBCHL-UIYHXYAWSA-N |
| XLogP | -0.32 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,4R)-5-[(1R)-1-fluoropropyl]piperidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-5-[(1R)-1-fluoropropyl]piperidine-3,4-diol?
The IUPAC name of (3R,4R)-5-[(1R)-1-fluoropropyl]piperidine-3,4-diol (CID 91824849) is (3R,4R)-5-[(1R)-1-fluoropropyl]piperidine-3,4-diol.
What is the SMILES notation for (3R,4R)-5-[(1R)-1-fluoropropyl]piperidine-3,4-diol?
The canonical SMILES for (3R,4R)-5-[(1R)-1-fluoropropyl]piperidine-3,4-diol is CC[C@@H](F)C1CNC[C@@H](O)[C@@H]1O.
What is the InChIKey of (3R,4R)-5-[(1R)-1-fluoropropyl]piperidine-3,4-diol?
The InChIKey is JJOAXUOFRVBCHL-UIYHXYAWSA-N. The full InChI is InChI=1S/C8H16FNO2/c1-2-6(9)5-3-10-4-7(11)8(5)12/h5-8,10-12H,2-4H2,1H3/t5?,6-,7-,8-/m1/s1.
What are the key properties of (3R,4R)-5-[(1R)-1-fluoropropyl]piperidine-3,4-diol?
(3R,4R)-5-[(1R)-1-fluoropropyl]piperidine-3,4-diol has a molecular weight of 177.22 g/mol, XLogP of -0.32, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-5-[(1R)-1-fluoropropyl]piperidine-3,4-diol is sourced from PubChem (CID 91824849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).