C16H28O — CID 20658905
(E)-3,4-dimethyl-5-(2,2,3-trimethylcyclopent-3-en-1-yl)hex-3-en-2-ol (PubChem CID 20658905) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is (E)-3,4-dimethyl-5-(2,2,3-trimethylcyclopent-3-en-1-yl)hex-3-en-2-ol.
| Compound Name | (E)-3,4-dimethyl-5-(2,2,3-trimethylcyclopent-3-en-1-yl)hex-3-en-2-ol |
|---|---|
| PubChem CID | 20658905 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | (E)-3,4-dimethyl-5-(2,2,3-trimethylcyclopent-3-en-1-yl)hex-3-en-2-ol |
| SMILES | CC1=CCC(C(C)/C(C)=C(\C)C(C)O)C1(C)C |
| InChI | InChI=1S/C16H28O/c1-10-8-9-15(16(10,6)7)13(4)11(2)12(3)14(5)17/h8,13-15,17H,9H2,1-7H3/b12-11+ |
| InChIKey | MQTODLXKTSXIDR-VAWYXSNFSA-N |
| XLogP | 4.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|