C15H25NO6 — CID 20659246
[3-[[2-[1-(2-methylpropoxy)ethoxy]-2-oxoethyl]amino]-3-oxopropyl] 2-methylprop-2-enoate (PubChem CID 20659246) has the molecular formula C15H25NO6 and a molecular weight of 315.37 g/mol. Its IUPAC name is [3-[[2-[1-(2-methylpropoxy)ethoxy]-2-oxoethyl]amino]-3-oxopropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[[2-[1-(2-methylpropoxy)ethoxy]-2-oxoethyl]amino]-3-oxopropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 20659246 |
| Molecular Formula | C15H25NO6 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | [3-[[2-[1-(2-methylpropoxy)ethoxy]-2-oxoethyl]amino]-3-oxopropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(=O)NCC(=O)OC(C)OCC(C)C |
| InChI | InChI=1S/C15H25NO6/c1-10(2)9-21-12(5)22-14(18)8-16-13(17)6-7-20-15(19)11(3)4/h10,12H,3,6-9H2,1-2,4-5H3,(H,16,17) |
| InChIKey | TZONFCVIQBSDLE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|