C5H13N3O2 — CID 20660155
1-(2,2-dihydroxyethyl)-1-ethylguanidine (PubChem CID 20660155) has the molecular formula C5H13N3O2 and a molecular weight of 147.18 g/mol. Its IUPAC name is 1-(2,2-dihydroxyethyl)-1-ethylguanidine.
| Compound Name | 1-(2,2-dihydroxyethyl)-1-ethylguanidine |
|---|---|
| PubChem CID | 20660155 |
| Molecular Formula | C5H13N3O2 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 1-(2,2-dihydroxyethyl)-1-ethylguanidine |
| SMILES | [H]/N=C(\N)N(CC)CC(O)O |
| InChI | InChI=1S/C5H13N3O2/c1-2-8(5(6)7)3-4(9)10/h4,9-10H,2-3H2,1H3,(H3,6,7) |
| InChIKey | XCAOPCCLJDYYHX-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|