C11H16 — CID 20661109
2,3-dimethyl-4,5,6,7-tetrahydro-1H-indene (PubChem CID 20661109) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is 2,3-dimethyl-4,5,6,7-tetrahydro-1H-indene.
| Compound Name | 2,3-dimethyl-4,5,6,7-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 20661109 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | 2,3-dimethyl-4,5,6,7-tetrahydro-1H-indene |
| SMILES | CC1=C(C)C2=C(CCCC2)C1 |
| InChI | InChI=1S/C11H16/c1-8-7-10-5-3-4-6-11(10)9(8)2/h3-7H2,1-2H3 |
| InChIKey | RENBNDPOTJKPKP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |