C18H18F2N4O5 — CID 20662620
2-isocyanoethyl 4-(3,4-difluorophenyl)-6-(methoxymethyl)-3-(methylcarbamoyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 20662620) has the molecular formula C18H18F2N4O5 and a molecular weight of 408.36 g/mol. Its IUPAC name is 2-isocyanoethyl 4-(3,4-difluorophenyl)-6-(methoxymethyl)-3-(methylcarbamoyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | 2-isocyanoethyl 4-(3,4-difluorophenyl)-6-(methoxymethyl)-3-(methylcarbamoyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 20662620 |
| Molecular Formula | C18H18F2N4O5 |
| Molecular Weight | 408.36 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 2-isocyanoethyl 4-(3,4-difluorophenyl)-6-(methoxymethyl)-3-(methylcarbamoyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | [C-]#[N+]CCOC(=O)C1=C(COC)NC(=O)N(C(=O)NC)C1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H18F2N4O5/c1-21-6-7-29-16(25)14-13(9-28-3)23-18(27)24(17(26)22-2)15(14)10-4-5-11(19)12(20)8-10/h4-5,8,15H,6-7,9H2,2-3H3,(H,22,26)(H,23,27) |
| InChIKey | NNJHVYXKTNPVNX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 101.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|