C18H19F2N5O6 — CID 91061659
methyl 4-(3,4-difluorophenyl)-3-[[(2E)-2-hydroxyimino-2-(methylideneamino)ethyl]carbamoyl]-6-(methoxymethyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 91061659) has the molecular formula C18H19F2N5O6 and a molecular weight of 439.38 g/mol. Its IUPAC name is methyl 4-(3,4-difluorophenyl)-3-[[(2E)-2-hydroxyimino-2-(methylideneamino)ethyl]carbamoyl]-6-(methoxymethyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | methyl 4-(3,4-difluorophenyl)-3-[[(2E)-2-hydroxyimino-2-(methylideneamino)ethyl]carbamoyl]-6-(methoxymethyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 91061659 |
| Molecular Formula | C18H19F2N5O6 |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | methyl 4-(3,4-difluorophenyl)-3-[[(2E)-2-hydroxyimino-2-(methylideneamino)ethyl]carbamoyl]-6-(methoxymethyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | C=N/C(CNC(=O)N1C(=O)NC(COC)=C(C(=O)OC)C1c1ccc(F)c(F)c1)=N/O |
| InChI | InChI=1S/C18H19F2N5O6/c1-21-13(24-29)7-22-17(27)25-15(9-4-5-10(19)11(20)6-9)14(16(26)31-3)12(8-30-2)23-18(25)28/h4-6,15,29H,1,7-8H2,2-3H3,(H,22,27)(H,23,28)/b24-13+ |
| InChIKey | SAOFPMAUFFPDLU-ZMOGYAJESA-N |
| XLogP | 1.30 |
| TPSA | 141.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|