About 3-ethoxypropyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate
3-ethoxypropyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 20662815) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is 3-ethoxypropyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate.
Molecular Properties
| Compound Name | 3-ethoxypropyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate |
| PubChem CID | 20662815 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 3-ethoxypropyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | CCOCCCOC(=O)C1CCC2OC2C1 |
| InChI | InChI=1S/C12H20O4/c1-2-14-6-3-7-15-12(13)9-4-5-10-11(8-9)16-10/h9-11H,2-8H2,1H3 |
| InChIKey | SMGLWBZJPBBBRR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxypropyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxypropyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate?
The IUPAC name of 3-ethoxypropyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate (CID 20662815) is 3-ethoxypropyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate.
What is the SMILES notation for 3-ethoxypropyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate?
The canonical SMILES for 3-ethoxypropyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate is CCOCCCOC(=O)C1CCC2OC2C1.
What is the InChIKey of 3-ethoxypropyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate?
The InChIKey is SMGLWBZJPBBBRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4/c1-2-14-6-3-7-15-12(13)9-4-5-10-11(8-9)16-10/h9-11H,2-8H2,1H3.
What are the key properties of 3-ethoxypropyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate?
3-ethoxypropyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate has a molecular weight of 228.29 g/mol, XLogP of 1.52, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxypropyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate is sourced from PubChem (CID 20662815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).