C19H22N2O4S — CID 20662979
[(E)-[cyano-(4-methylphenyl)methylidene]amino]oxy (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfinate (PubChem CID 20662979) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is [(E)-[cyano-(4-methylphenyl)methylidene]amino]oxy (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfinate.
| Compound Name | [(E)-[cyano-(4-methylphenyl)methylidene]amino]oxy (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfinate |
|---|---|
| PubChem CID | 20662979 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | [(E)-[cyano-(4-methylphenyl)methylidene]amino]oxy (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfinate |
| SMILES | Cc1ccc(/C(C#N)=N\OOS(=O)CC23CCC(CC2=O)C3(C)C)cc1 |
| InChI | InChI=1S/C19H22N2O4S/c1-13-4-6-14(7-5-13)16(11-20)21-24-25-26(23)12-19-9-8-15(10-17(19)22)18(19,2)3/h4-7,15H,8-10,12H2,1-3H3/b21-16- |
| InChIKey | NVSLOOXXSCWVCI-PGMHBOJBSA-N |
| XLogP | 3.23 |
| TPSA | 88.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|