C18H14F2N2 — CID 20663234
3-[2,3-difluoro-4-(4-methylphenyl)phenyl]-6-methylpyridazine (PubChem CID 20663234) has the molecular formula C18H14F2N2 and a molecular weight of 296.32 g/mol. Its IUPAC name is 3-[2,3-difluoro-4-(4-methylphenyl)phenyl]-6-methylpyridazine.
| Compound Name | 3-[2,3-difluoro-4-(4-methylphenyl)phenyl]-6-methylpyridazine |
|---|---|
| PubChem CID | 20663234 |
| Molecular Formula | C18H14F2N2 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 3-[2,3-difluoro-4-(4-methylphenyl)phenyl]-6-methylpyridazine |
| SMILES | Cc1ccc(-c2ccc(-c3ccc(C)nn3)c(F)c2F)cc1 |
| InChI | InChI=1S/C18H14F2N2/c1-11-3-6-13(7-4-11)14-8-9-15(18(20)17(14)19)16-10-5-12(2)21-22-16/h3-10H,1-2H3 |
| InChIKey | FGPNBWSSBXWSIE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |