C24H20O3 — CID 20663270
[4-[4-(2-hydroxybut-3-ynyl)phenyl]phenyl] 4-methylbenzoate (PubChem CID 20663270) has the molecular formula C24H20O3 and a molecular weight of 356.42 g/mol. Its IUPAC name is [4-[4-(2-hydroxybut-3-ynyl)phenyl]phenyl] 4-methylbenzoate.
| Compound Name | [4-[4-(2-hydroxybut-3-ynyl)phenyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 20663270 |
| Molecular Formula | C24H20O3 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | [4-[4-(2-hydroxybut-3-ynyl)phenyl]phenyl] 4-methylbenzoate |
| SMILES | C#CC(O)Cc1ccc(-c2ccc(OC(=O)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H20O3/c1-3-22(25)16-18-6-10-19(11-7-18)20-12-14-23(15-13-20)27-24(26)21-8-4-17(2)5-9-21/h1,4-15,22,25H,16H2,2H3 |
| InChIKey | HSWVVWKHMQRSCY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|