C26H25N5O — CID 20664630
1-[3-[(4-isocyanophenyl)methyl]imidazole-4-carbonyl]-4-[(2-methylphenyl)methyl]piperidine-4-carbonitrile (PubChem CID 20664630) has the molecular formula C26H25N5O and a molecular weight of 423.52 g/mol. Its IUPAC name is 1-[3-[(4-isocyanophenyl)methyl]imidazole-4-carbonyl]-4-[(2-methylphenyl)methyl]piperidine-4-carbonitrile.
| Compound Name | 1-[3-[(4-isocyanophenyl)methyl]imidazole-4-carbonyl]-4-[(2-methylphenyl)methyl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 20664630 |
| Molecular Formula | C26H25N5O |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 1-[3-[(4-isocyanophenyl)methyl]imidazole-4-carbonyl]-4-[(2-methylphenyl)methyl]piperidine-4-carbonitrile |
| SMILES | [C-]#[N+]c1ccc(Cn2cncc2C(=O)N2CCC(C#N)(Cc3ccccc3C)CC2)cc1 |
| InChI | InChI=1S/C26H25N5O/c1-20-5-3-4-6-22(20)15-26(18-27)11-13-30(14-12-26)25(32)24-16-29-19-31(24)17-21-7-9-23(28-2)10-8-21/h3-10,16,19H,11-15,17H2,1H3 |
| InChIKey | LTFOVWAOVKVBGO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 66.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|