C30H28N4O2 — CID 20664666
[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]-[3-[(4-isocyanophenyl)methyl]imidazol-4-yl]methanone (PubChem CID 20664666) has the molecular formula C30H28N4O2 and a molecular weight of 476.58 g/mol. Its IUPAC name is [4-[hydroxy(diphenyl)methyl]piperidin-1-yl]-[3-[(4-isocyanophenyl)methyl]imidazol-4-yl]methanone.
| Compound Name | [4-[hydroxy(diphenyl)methyl]piperidin-1-yl]-[3-[(4-isocyanophenyl)methyl]imidazol-4-yl]methanone |
|---|---|
| PubChem CID | 20664666 |
| Molecular Formula | C30H28N4O2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | [4-[hydroxy(diphenyl)methyl]piperidin-1-yl]-[3-[(4-isocyanophenyl)methyl]imidazol-4-yl]methanone |
| SMILES | [C-]#[N+]c1ccc(Cn2cncc2C(=O)N2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C30H28N4O2/c1-31-27-14-12-23(13-15-27)21-34-22-32-20-28(34)29(35)33-18-16-26(17-19-33)30(36,24-8-4-2-5-9-24)25-10-6-3-7-11-25/h2-15,20,22,26,36H,16-19,21H2 |
| InChIKey | ZMCGFOVPTSJNGZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|