C26H14N4O2 — CID 20665511
4,7,19,22-tetrazaheptacyclo[16.12.0.03,16.05,14.06,11.020,29.021,26]triaconta-1,3(16),5(14),6(11),7,9,12,17,20(29),21(26),22,24,27-tridecaene-15,30-dione (PubChem CID 20665511) has the molecular formula C26H14N4O2 and a molecular weight of 414.42 g/mol. Its IUPAC name is 4,7,19,22-tetrazaheptacyclo[16.12.0.03,16.05,14.06,11.020,29.021,26]triaconta-1,3(16),5(14),6(11),7,9,12,17,20(29),21(26),22,24,27-tridecaene-15,30-dione.
| Compound Name | 4,7,19,22-tetrazaheptacyclo[16.12.0.03,16.05,14.06,11.020,29.021,26]triaconta-1,3(16),5(14),6(11),7,9,12,17,20(29),21(26),22,24,27-tridecaene-15,30-dione |
|---|---|
| PubChem CID | 20665511 |
| Molecular Formula | C26H14N4O2 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 4,7,19,22-tetrazaheptacyclo[16.12.0.03,16.05,14.06,11.020,29.021,26]triaconta-1,3(16),5(14),6(11),7,9,12,17,20(29),21(26),22,24,27-tridecaene-15,30-dione |
| SMILES | O=c1c2cc3[nH]c4c(ccc5cccnc54)c(=O)c3cc2[nH]c2c1ccc1cccnc12 |
| InChI | InChI=1S/C26H14N4O2/c31-25-15-7-5-13-3-1-9-27-21(13)23(15)29-19-11-18-20(12-17(19)25)30-24-16(26(18)32)8-6-14-4-2-10-28-22(14)24/h1-12H,(H,29,31)(H,30,32) |
| InChIKey | ZQBLRPDVAFQGEV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|