About CID 20665518
CID 20665518 (PubChem CID 20665518) has the molecular formula C10H8GaNO
and a molecular weight of 227.90 g/mol.
Molecular Properties
| Compound Name | CID 20665518 |
| PubChem CID | 20665518 |
| Molecular Formula | C10H8GaNO |
| Molecular Weight | 227.90 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | — |
| SMILES | Cc1ccc2cccc(O[Ga])c2n1 |
| InChI | InChI=1S/C10H9NO.Ga/c1-7-5-6-8-3-2-4-9(12)10(8)11-7;/h2-6,12H,1H3;/q;+1/p-1 |
| InChIKey | IBPLLQOCRNBJHA-UHFFFAOYSA-M |
| XLogP | 2.01 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.90 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 20665518 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20665518?
The IUPAC name of CID 20665518 (CID 20665518) is not available.
What is the SMILES notation for CID 20665518?
The canonical SMILES for CID 20665518 is Cc1ccc2cccc(O[Ga])c2n1.
What is the InChIKey of CID 20665518?
The InChIKey is IBPLLQOCRNBJHA-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H9NO.Ga/c1-7-5-6-8-3-2-4-9(12)10(8)11-7;/h2-6,12H,1H3;/q;+1/p-1.
What are the key properties of CID 20665518?
CID 20665518 has a molecular weight of 227.90 g/mol, XLogP of 2.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20665518 is sourced from PubChem (CID 20665518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).