C31H29ClF5N3O — CID 20666483
N-[2-[3-[chloro(difluoro)methyl]-5-(trifluoromethyl)phenyl]ethyl]-2-(4-isocyano-4-phenylpiperidin-1-yl)-N-methyl-2-phenylacetamide (PubChem CID 20666483) has the molecular formula C31H29ClF5N3O and a molecular weight of 590.04 g/mol. Its IUPAC name is N-[2-[3-[chloro(difluoro)methyl]-5-(trifluoromethyl)phenyl]ethyl]-2-(4-isocyano-4-phenylpiperidin-1-yl)-N-methyl-2-phenylacetamide.
| Compound Name | N-[2-[3-[chloro(difluoro)methyl]-5-(trifluoromethyl)phenyl]ethyl]-2-(4-isocyano-4-phenylpiperidin-1-yl)-N-methyl-2-phenylacetamide |
|---|---|
| PubChem CID | 20666483 |
| Molecular Formula | C31H29ClF5N3O |
| Molecular Weight | 590.04 g/mol |
| Exact Mass | 589.19 |
| IUPAC Name | N-[2-[3-[chloro(difluoro)methyl]-5-(trifluoromethyl)phenyl]ethyl]-2-(4-isocyano-4-phenylpiperidin-1-yl)-N-methyl-2-phenylacetamide |
| SMILES | [C-]#[N+]C1(c2ccccc2)CCN(C(C(=O)N(C)CCc2cc(C(F)(F)F)cc(C(F)(F)Cl)c2)c2ccccc2)CC1 |
| InChI | InChI=1S/C31H29ClF5N3O/c1-38-29(24-11-7-4-8-12-24)14-17-40(18-15-29)27(23-9-5-3-6-10-23)28(41)39(2)16-13-22-19-25(30(32,33)34)21-26(20-22)31(35,36)37/h3-12,19-21,27H,13-18H2,2H3 |
| InChIKey | JHKXSIQPKHUQHK-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 27.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.04 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|