C37H49F6N5O — CID 22957278
N-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-2-[4-(N,N'-dicyclohexyl-N-methylcarbamimidoyl)piperazin-1-yl]-N-methyl-2-phenylacetamide (PubChem CID 22957278) has the molecular formula C37H49F6N5O and a molecular weight of 693.82 g/mol. Its IUPAC name is N-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-2-[4-(N,N'-dicyclohexyl-N-methylcarbamimidoyl)piperazin-1-yl]-N-methyl-2-phenylacetamide.
| Compound Name | N-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-2-[4-(N,N'-dicyclohexyl-N-methylcarbamimidoyl)piperazin-1-yl]-N-methyl-2-phenylacetamide |
|---|---|
| PubChem CID | 22957278 |
| Molecular Formula | C37H49F6N5O |
| Molecular Weight | 693.82 g/mol |
| Exact Mass | 693.38 |
| IUPAC Name | N-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-2-[4-(N,N'-dicyclohexyl-N-methylcarbamimidoyl)piperazin-1-yl]-N-methyl-2-phenylacetamide |
| SMILES | CN(CCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)C(c1ccccc1)N1CCN(/C(=N\C2CCCCC2)N(C)C2CCCCC2)CC1 |
| InChI | InChI=1S/C37H49F6N5O/c1-45(19-18-27-24-29(36(38,39)40)26-30(25-27)37(41,42)43)34(49)33(28-12-6-3-7-13-28)47-20-22-48(23-21-47)35(44-31-14-8-4-9-15-31)46(2)32-16-10-5-11-17-32/h3,6-7,12-13,24-26,31-33H,4-5,8-11,14-23H2,1-2H3/b44-35- |
| InChIKey | KMCHHYRMLAZOAV-QJOMKUNGSA-N |
| XLogP | 8.04 |
| TPSA | 42.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.82 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|