About 4-ethyliminopentanoic acid
4-ethyliminopentanoic acid (PubChem CID 20666902) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is 4-ethyliminopentanoic acid.
Molecular Properties
| Compound Name | 4-ethyliminopentanoic acid |
| PubChem CID | 20666902 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 4-ethyliminopentanoic acid |
| SMILES | CC/N=C(\C)CCC(=O)O |
| InChI | InChI=1S/C7H13NO2/c1-3-8-6(2)4-5-7(9)10/h3-5H2,1-2H3,(H,9,10)/b8-6+ |
| InChIKey | MIIRLJXZJKTTIX-SOFGYWHQSA-N |
| XLogP | 1.33 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyliminopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyliminopentanoic acid?
The IUPAC name of 4-ethyliminopentanoic acid (CID 20666902) is 4-ethyliminopentanoic acid.
What is the SMILES notation for 4-ethyliminopentanoic acid?
The canonical SMILES for 4-ethyliminopentanoic acid is CC/N=C(\C)CCC(=O)O.
What is the InChIKey of 4-ethyliminopentanoic acid?
The InChIKey is MIIRLJXZJKTTIX-SOFGYWHQSA-N. The full InChI is InChI=1S/C7H13NO2/c1-3-8-6(2)4-5-7(9)10/h3-5H2,1-2H3,(H,9,10)/b8-6+.
What are the key properties of 4-ethyliminopentanoic acid?
4-ethyliminopentanoic acid has a molecular weight of 143.19 g/mol, XLogP of 1.33, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyliminopentanoic acid is sourced from PubChem (CID 20666902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).