About 5-ethyliminohexan-2-one
5-ethyliminohexan-2-one (PubChem CID 20666906) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is 5-ethyliminohexan-2-one.
Molecular Properties
| Compound Name | 5-ethyliminohexan-2-one |
| PubChem CID | 20666906 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 5-ethyliminohexan-2-one |
| SMILES | CC/N=C(\C)CCC(C)=O |
| InChI | InChI=1S/C8H15NO/c1-4-9-7(2)5-6-8(3)10/h4-6H2,1-3H3/b9-7+ |
| InChIKey | UBZXWHKNSVBBSO-VQHVLOKHSA-N |
| XLogP | 1.84 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyliminohexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyliminohexan-2-one?
The IUPAC name of 5-ethyliminohexan-2-one (CID 20666906) is 5-ethyliminohexan-2-one.
What is the SMILES notation for 5-ethyliminohexan-2-one?
The canonical SMILES for 5-ethyliminohexan-2-one is CC/N=C(\C)CCC(C)=O.
What is the InChIKey of 5-ethyliminohexan-2-one?
The InChIKey is UBZXWHKNSVBBSO-VQHVLOKHSA-N. The full InChI is InChI=1S/C8H15NO/c1-4-9-7(2)5-6-8(3)10/h4-6H2,1-3H3/b9-7+.
What are the key properties of 5-ethyliminohexan-2-one?
5-ethyliminohexan-2-one has a molecular weight of 141.21 g/mol, XLogP of 1.84, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyliminohexan-2-one is sourced from PubChem (CID 20666906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).