C6H9NO — CID 146018659
1-(2,3,3,4,4-pentadeuterio-2H-pyrrol-5-yl)ethanone (PubChem CID 146018659) has the molecular formula C6H9NO and a molecular weight of 116.17 g/mol. Its IUPAC name is 1-(2,3,3,4,4-pentadeuterio-2H-pyrrol-5-yl)ethanone.
| Compound Name | 1-(2,3,3,4,4-pentadeuterio-2H-pyrrol-5-yl)ethanone |
|---|---|
| PubChem CID | 146018659 |
| Molecular Formula | C6H9NO |
| Molecular Weight | 116.17 g/mol |
| Exact Mass | 116.10 |
| IUPAC Name | 1-(2,3,3,4,4-pentadeuterio-2H-pyrrol-5-yl)ethanone |
| SMILES | [2H]C1N=C(C(C)=O)C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C6H9NO/c1-5(8)6-3-2-4-7-6/h2-4H2,1H3/i2D2,3D2,4D |
| InChIKey | DQBQWWSFRPLIAX-OOCCYNIISA-N |
| XLogP | 0.81 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.17 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |