C9H18N2O3 — CID 20668247
4-acetamido-3-hydroxy-N,N-dimethylpentanamide (PubChem CID 20668247) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is 4-acetamido-3-hydroxy-N,N-dimethylpentanamide.
| Compound Name | 4-acetamido-3-hydroxy-N,N-dimethylpentanamide |
|---|---|
| PubChem CID | 20668247 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 4-acetamido-3-hydroxy-N,N-dimethylpentanamide |
| SMILES | CC(=O)NC(C)C(O)CC(=O)N(C)C |
| InChI | InChI=1S/C9H18N2O3/c1-6(10-7(2)12)8(13)5-9(14)11(3)4/h6,8,13H,5H2,1-4H3,(H,10,12) |
| InChIKey | SEMKIAVMLWCVOL-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |