C11H23N3O+2 — CID 20668355
2-(4-propyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide (PubChem CID 20668355) has the molecular formula C11H23N3O+2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-(4-propyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide.
| Compound Name | 2-(4-propyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide |
|---|---|
| PubChem CID | 20668355 |
| Molecular Formula | C11H23N3O+2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 2-(4-propyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide |
| SMILES | CCC[N+]12CC[N+](CC(N)=O)(CC1)CC2 |
| InChI | InChI=1S/C11H22N3O/c1-2-3-13-4-7-14(8-5-13,9-6-13)10-11(12)15/h2-10H2,1H3,(H-,12,15)/q+1/p+1 |
| InChIKey | XMIHARBAILDKCF-UHFFFAOYSA-O |
| XLogP | -0.46 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|