C12H16N2O3 — CID 20668742
1,6-dimethyl-4-(morpholine-4-carbonyl)pyridin-2-one (PubChem CID 20668742) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 1,6-dimethyl-4-(morpholine-4-carbonyl)pyridin-2-one.
| Compound Name | 1,6-dimethyl-4-(morpholine-4-carbonyl)pyridin-2-one |
|---|---|
| PubChem CID | 20668742 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 1,6-dimethyl-4-(morpholine-4-carbonyl)pyridin-2-one |
| SMILES | Cc1cc(C(=O)N2CCOCC2)cc(=O)n1C |
| InChI | InChI=1S/C12H16N2O3/c1-9-7-10(8-11(15)13(9)2)12(16)14-3-5-17-6-4-14/h7-8H,3-6H2,1-2H3 |
| InChIKey | GFFDVEWLCNBJPL-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |