C30H27ClN6O4S — CID 20669695
N-[3-(6-anilinoperoxysulfanyl-5-chloro-7-cyano-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl)phenyl]-2-(2,4-dimethylphenoxy)butanamide (PubChem CID 20669695) has the molecular formula C30H27ClN6O4S and a molecular weight of 603.10 g/mol. Its IUPAC name is N-[3-(6-anilinoperoxysulfanyl-5-chloro-7-cyano-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl)phenyl]-2-(2,4-dimethylphenoxy)butanamide.
| Compound Name | N-[3-(6-anilinoperoxysulfanyl-5-chloro-7-cyano-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl)phenyl]-2-(2,4-dimethylphenoxy)butanamide |
|---|---|
| PubChem CID | 20669695 |
| Molecular Formula | C30H27ClN6O4S |
| Molecular Weight | 603.10 g/mol |
| Exact Mass | 602.15 |
| IUPAC Name | N-[3-(6-anilinoperoxysulfanyl-5-chloro-7-cyano-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl)phenyl]-2-(2,4-dimethylphenoxy)butanamide |
| SMILES | CCC(Oc1ccc(C)cc1C)C(=O)Nc1cccc(-c2nc3c(C#N)c(SOONc4ccccc4)c(Cl)n3[nH]2)c1 |
| InChI | InChI=1S/C30H27ClN6O4S/c1-4-24(39-25-14-13-18(2)15-19(25)3)30(38)33-22-12-8-9-20(16-22)28-34-29-23(17-32)26(27(31)37(29)35-28)42-41-40-36-21-10-6-5-7-11-21/h5-16,24,36H,4H2,1-3H3,(H,33,38)(H,34,35) |
| InChIKey | OGNOBNNCQFDZEL-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.10 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|