C38H48N6O4 — CID 20682003
[7-[(2,6-dimethylcyclohexyl)methyl]-2-[3-[2-(2,4-dimethylphenoxy)butanoylamino]phenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] N,N-diethylcarbamate (PubChem CID 20682003) has the molecular formula C38H48N6O4 and a molecular weight of 652.84 g/mol. Its IUPAC name is [7-[(2,6-dimethylcyclohexyl)methyl]-2-[3-[2-(2,4-dimethylphenoxy)butanoylamino]phenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] N,N-diethylcarbamate.
| Compound Name | [7-[(2,6-dimethylcyclohexyl)methyl]-2-[3-[2-(2,4-dimethylphenoxy)butanoylamino]phenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 20682003 |
| Molecular Formula | C38H48N6O4 |
| Molecular Weight | 652.84 g/mol |
| Exact Mass | 652.37 |
| IUPAC Name | [7-[(2,6-dimethylcyclohexyl)methyl]-2-[3-[2-(2,4-dimethylphenoxy)butanoylamino]phenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] N,N-diethylcarbamate |
| SMILES | [C-]#[N+]c1c(CC2C(C)CCCC2C)c2nc(-c3cccc(NC(=O)C(CC)Oc4ccc(C)cc4C)c3)[nH]n2c1OC(=O)N(CC)CC |
| InChI | InChI=1S/C38H48N6O4/c1-9-31(47-32-19-18-23(4)20-26(32)7)36(45)40-28-17-13-16-27(21-28)34-41-35-30(22-29-24(5)14-12-15-25(29)6)33(39-8)37(44(35)42-34)48-38(46)43(10-2)11-3/h13,16-21,24-25,29,31H,9-12,14-15,22H2,1-7H3,(H,40,45)(H,41,42) |
| InChIKey | LUDOMJKHELBHGT-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.84 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|