C49H53N5O6 — CID 20669650
(2,4,6-trimethylcyclohexyl) 2-[3-[2-(2,4-dimethylphenoxy)octanoylamino]phenyl]-6-isocyano-5-(naphthalene-1-carbonyloxy)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 20669650) has the molecular formula C49H53N5O6 and a molecular weight of 807.99 g/mol. Its IUPAC name is (2,4,6-trimethylcyclohexyl) 2-[3-[2-(2,4-dimethylphenoxy)octanoylamino]phenyl]-6-isocyano-5-(naphthalene-1-carbonyloxy)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,4,6-trimethylcyclohexyl) 2-[3-[2-(2,4-dimethylphenoxy)octanoylamino]phenyl]-6-isocyano-5-(naphthalene-1-carbonyloxy)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 20669650 |
| Molecular Formula | C49H53N5O6 |
| Molecular Weight | 807.99 g/mol |
| Exact Mass | 807.40 |
| IUPAC Name | (2,4,6-trimethylcyclohexyl) 2-[3-[2-(2,4-dimethylphenoxy)octanoylamino]phenyl]-6-isocyano-5-(naphthalene-1-carbonyloxy)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1c(C(=O)OC2C(C)CC(C)CC2C)c2nc(-c3cccc(NC(=O)C(CCCCCC)Oc4ccc(C)cc4C)c3)[nH]n2c1OC(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C49H53N5O6/c1-8-9-10-11-22-40(58-39-24-23-29(2)25-31(39)4)46(55)51-36-19-14-18-35(28-36)44-52-45-41(49(57)59-43-32(5)26-30(3)27-33(43)6)42(50-7)47(54(45)53-44)60-48(56)38-21-15-17-34-16-12-13-20-37(34)38/h12-21,23-25,28,30,32-33,40,43H,8-11,22,26-27H2,1-6H3,(H,51,55)(H,52,53) |
| InChIKey | PTSJZXMPFAHZEC-UHFFFAOYSA-N |
| XLogP | 11.45 |
| TPSA | 128.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.99 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|