C35H36Cl3N6O4+ — CID 20670759
3-[2-(4-methyl-2-pentylphenoxy)butanoylamino]-N-[5-oxo-4-(1H-pyrazol-2-ium-2-yl)-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]benzamide (PubChem CID 20670759) has the molecular formula C35H36Cl3N6O4+ and a molecular weight of 711.07 g/mol. Its IUPAC name is 3-[2-(4-methyl-2-pentylphenoxy)butanoylamino]-N-[5-oxo-4-(1H-pyrazol-2-ium-2-yl)-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]benzamide.
| Compound Name | 3-[2-(4-methyl-2-pentylphenoxy)butanoylamino]-N-[5-oxo-4-(1H-pyrazol-2-ium-2-yl)-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 20670759 |
| Molecular Formula | C35H36Cl3N6O4+ |
| Molecular Weight | 711.07 g/mol |
| Exact Mass | 709.19 |
| IUPAC Name | 3-[2-(4-methyl-2-pentylphenoxy)butanoylamino]-N-[5-oxo-4-(1H-pyrazol-2-ium-2-yl)-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]benzamide |
| SMILES | CCCCCc1cc(C)ccc1OC(CC)C(=O)Nc1cccc(C(=O)NC2=NN(c3c(Cl)cc(Cl)cc3Cl)C(=O)C2[n+]2ccc[nH]2)c1 |
| InChI | InChI=1S/C35H35Cl3N6O4/c1-4-6-7-10-22-17-21(3)13-14-29(22)48-28(5-2)34(46)40-25-12-8-11-23(18-25)33(45)41-32-31(43-16-9-15-39-43)35(47)44(42-32)30-26(37)19-24(36)20-27(30)38/h8-9,11-20,28,31H,4-7,10H2,1-3H3,(H2,40,41,42,45,46)/p+1 |
| InChIKey | CAFOQOWXHAADLI-UHFFFAOYSA-O |
| XLogP | 7.43 |
| TPSA | 119.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.07 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|